About 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile
3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile (PubChem CID 67528824) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile |
| PubChem CID | 67528824 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(CCN3C(=O)COC3=O)cc2)c1 |
| InChI | InChI=1S/C18H14N2O3/c19-11-14-2-1-3-16(10-14)15-6-4-13(5-7-15)8-9-20-17(21)12-23-18(20)22/h1-7,10H,8-9,12H2 |
| InChIKey | MVXXDXAZKIHPQG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile?
The IUPAC name of 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile (CID 67528824) is 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile.
What is the SMILES notation for 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile?
The canonical SMILES for 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile is N#Cc1cccc(-c2ccc(CCN3C(=O)COC3=O)cc2)c1.
What is the InChIKey of 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile?
The InChIKey is MVXXDXAZKIHPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3/c19-11-14-2-1-3-16(10-14)15-6-4-13(5-7-15)8-9-20-17(21)12-23-18(20)22/h1-7,10H,8-9,12H2.
What are the key properties of 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile?
3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile has a molecular weight of 306.32 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)ethyl]phenyl]benzonitrile is sourced from PubChem (CID 67528824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).