C22H14N2O4 — CID 67530487
methyl 7-hydroxy-2-phenyl-4-(2-phenylethynyl)-[1,3]oxazolo[4,5-c]pyridine-6-carboxylate (PubChem CID 67530487) has the molecular formula C22H14N2O4 and a molecular weight of 370.36 g/mol. Its IUPAC name is methyl 7-hydroxy-2-phenyl-4-(2-phenylethynyl)-[1,3]oxazolo[4,5-c]pyridine-6-carboxylate.
| Compound Name | methyl 7-hydroxy-2-phenyl-4-(2-phenylethynyl)-[1,3]oxazolo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 67530487 |
| Molecular Formula | C22H14N2O4 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | methyl 7-hydroxy-2-phenyl-4-(2-phenylethynyl)-[1,3]oxazolo[4,5-c]pyridine-6-carboxylate |
| SMILES | COC(=O)c1nc(C#Cc2ccccc2)c2nc(-c3ccccc3)oc2c1O |
| InChI | InChI=1S/C22H14N2O4/c1-27-22(26)18-19(25)20-17(24-21(28-20)15-10-6-3-7-11-15)16(23-18)13-12-14-8-4-2-5-9-14/h2-11,25H,1H3 |
| InChIKey | OFMALRQVIAFYBT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|