C18H12O6 — CID 67535301
13-ethoxycarbonyl-5,12-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,6,8(16),9,11(15),13-heptaene-6-carboxylic acid (PubChem CID 67535301) has the molecular formula C18H12O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is 13-ethoxycarbonyl-5,12-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,6,8(16),9,11(15),13-heptaene-6-carboxylic acid.
| Compound Name | 13-ethoxycarbonyl-5,12-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,6,8(16),9,11(15),13-heptaene-6-carboxylic acid |
|---|---|
| PubChem CID | 67535301 |
| Molecular Formula | C18H12O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 13-ethoxycarbonyl-5,12-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,6,8(16),9,11(15),13-heptaene-6-carboxylic acid |
| SMILES | CCOC(=O)C1=Cc2ccc3c4c(ccc(c24)O1)C=C(C(=O)O)O3 |
| InChI | InChI=1S/C18H12O6/c1-2-22-18(21)14-8-10-4-5-11-15-9(7-13(23-11)17(19)20)3-6-12(24-14)16(10)15/h3-8H,2H2,1H3,(H,19,20) |
| InChIKey | HWXAGZALKYSVGR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |