C33H46N4O4 — CID 67535608
2-methylpropyl N-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]carbamate (PubChem CID 67535608) has the molecular formula C33H46N4O4 and a molecular weight of 562.76 g/mol. Its IUPAC name is 2-methylpropyl N-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67535608 |
| Molecular Formula | C33H46N4O4 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | 2-methylpropyl N-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]carbamate |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)Cc3ccc(NC(=O)OCC(C)C)cc3)C2)c(C)c2ccccc21 |
| InChI | InChI=1S/C33H46N4O4/c1-23(2)22-41-33(39)35-28-14-12-25(13-15-28)19-27(34)20-31(38)36-16-7-9-26(21-36)32-24(3)29-10-5-6-11-30(29)37(32)17-8-18-40-4/h5-6,10-15,23,26-27H,7-9,16-22,34H2,1-4H3,(H,35,39) |
| InChIKey | RMROOCIIJOEADJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|