C32H42N4O3 — CID 67536404
N-[4-[(2R)-2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]cyclopropanecarboxamide (PubChem CID 67536404) has the molecular formula C32H42N4O3 and a molecular weight of 530.71 g/mol. Its IUPAC name is N-[4-[(2R)-2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(2R)-2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 67536404 |
| Molecular Formula | C32H42N4O3 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | N-[4-[(2R)-2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]cyclopropanecarboxamide |
| SMILES | COCCCn1c(C2CCCN(C(=O)C[C@H](N)Cc3ccc(NC(=O)C4CC4)cc3)C2)c(C)c2ccccc21 |
| InChI | InChI=1S/C32H42N4O3/c1-22-28-8-3-4-9-29(28)36(17-6-18-39-2)31(22)25-7-5-16-35(21-25)30(37)20-26(33)19-23-10-14-27(15-11-23)34-32(38)24-12-13-24/h3-4,8-11,14-15,24-26H,5-7,12-13,16-21,33H2,1-2H3,(H,34,38)/t25?,26-/m1/s1 |
| InChIKey | OJDJBFGGMRYYCB-FXDYGKIASA-N |
| XLogP | 5.00 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|