C32H42N4O5 — CID 77309185
methyl 3-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]anilino]-3-oxopropanoate (PubChem CID 77309185) has the molecular formula C32H42N4O5 and a molecular weight of 562.71 g/mol. Its IUPAC name is methyl 3-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]anilino]-3-oxopropanoate.
| Compound Name | methyl 3-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 77309185 |
| Molecular Formula | C32H42N4O5 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | methyl 3-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]anilino]-3-oxopropanoate |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)Cc3ccc(NC(=O)CC(=O)OC)cc3)C2)c(C)c2ccccc21 |
| InChI | InChI=1S/C32H42N4O5/c1-22-27-9-4-5-10-28(27)36(16-7-17-40-2)32(22)24-8-6-15-35(21-24)30(38)19-25(33)18-23-11-13-26(14-12-23)34-29(37)20-31(39)41-3/h4-5,9-14,24-25H,6-8,15-21,33H2,1-3H3,(H,34,37) |
| InChIKey | NDCPKQSLNHEKIP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|