C34H46N4O4 — CID 77309536
N-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]oxane-2-carboxamide (PubChem CID 77309536) has the molecular formula C34H46N4O4 and a molecular weight of 574.77 g/mol. Its IUPAC name is N-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]oxane-2-carboxamide.
| Compound Name | N-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 77309536 |
| Molecular Formula | C34H46N4O4 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | N-[4-[2-amino-4-[3-[1-(3-methoxypropyl)-3-methylindol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]oxane-2-carboxamide |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)Cc3ccc(NC(=O)C4CCCCO4)cc3)C2)c(C)c2ccccc21 |
| InChI | InChI=1S/C34H46N4O4/c1-24-29-10-3-4-11-30(29)38(18-8-19-41-2)33(24)26-9-7-17-37(23-26)32(39)22-27(35)21-25-13-15-28(16-14-25)36-34(40)31-12-5-6-20-42-31/h3-4,10-11,13-16,26-27,31H,5-9,12,17-23,35H2,1-2H3,(H,36,40) |
| InChIKey | LPRICGRMVTYEKR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|