C22H33N3O3 — CID 67536294
tert-butyl (3R)-3-[7-(3-methoxypropyl)-4-methyl-1H-pyrrolo[3,2-c]pyridin-2-yl]piperidine-1-carboxylate (PubChem CID 67536294) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl (3R)-3-[7-(3-methoxypropyl)-4-methyl-1H-pyrrolo[3,2-c]pyridin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[7-(3-methoxypropyl)-4-methyl-1H-pyrrolo[3,2-c]pyridin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67536294 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | tert-butyl (3R)-3-[7-(3-methoxypropyl)-4-methyl-1H-pyrrolo[3,2-c]pyridin-2-yl]piperidine-1-carboxylate |
| SMILES | COCCCc1cnc(C)c2cc([C@@H]3CCCN(C(=O)OC(C)(C)C)C3)[nH]c12 |
| InChI | InChI=1S/C22H33N3O3/c1-15-18-12-19(24-20(18)16(13-23-15)9-7-11-27-5)17-8-6-10-25(14-17)21(26)28-22(2,3)4/h12-13,17,24H,6-11,14H2,1-5H3/t17-/m1/s1 |
| InChIKey | CSZPMYDLGMBYTM-QGZVFWFLSA-N |
| XLogP | 4.56 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|