C28H39N3O2 — CID 67543074
1-[4-(dimethylamino)phenyl]-2-[2-[3-(3-piperidin-1-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone (PubChem CID 67543074) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-2-[2-[3-(3-piperidin-1-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[4-(dimethylamino)phenyl]-2-[2-[3-(3-piperidin-1-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 67543074 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-2-[2-[3-(3-piperidin-1-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone |
| SMILES | CN(C)c1ccc(C(=O)CN2CCCC2c2cccc(OCCCN3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C28H39N3O2/c1-29(2)25-14-12-23(13-15-25)28(32)22-31-19-7-11-27(31)24-9-6-10-26(21-24)33-20-8-18-30-16-4-3-5-17-30/h6,9-10,12-15,21,27H,3-5,7-8,11,16-20,22H2,1-2H3 |
| InChIKey | KKVGQZRPKMYWMI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|