C26H34N2O3S — CID 67545408
1-(4-methylsulfanylphenyl)-2-[2-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone (PubChem CID 67545408) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-2-[2-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-(4-methylsulfanylphenyl)-2-[2-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 67545408 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-2-[2-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone |
| SMILES | CSc1ccc(C(=O)CN2CCCC2c2cccc(OCCCN3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C26H34N2O3S/c1-32-24-10-8-21(9-11-24)26(29)20-28-13-3-7-25(28)22-5-2-6-23(19-22)31-16-4-12-27-14-17-30-18-15-27/h2,5-6,8-11,19,25H,3-4,7,12-18,20H2,1H3 |
| InChIKey | CQQADZAOTBAQOR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|