C28H34N4O3 — CID 67542343
1-(4-imidazol-1-ylphenyl)-2-[2-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone (PubChem CID 67542343) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 1-(4-imidazol-1-ylphenyl)-2-[2-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-(4-imidazol-1-ylphenyl)-2-[2-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 67542343 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 1-(4-imidazol-1-ylphenyl)-2-[2-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CN1CCCC1c1cccc(OCCCN2CCOCC2)c1)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C28H34N4O3/c33-28(23-7-9-25(10-8-23)32-14-11-29-22-32)21-31-13-2-6-27(31)24-4-1-5-26(20-24)35-17-3-12-30-15-18-34-19-16-30/h1,4-5,7-11,14,20,22,27H,2-3,6,12-13,15-19,21H2 |
| InChIKey | YDTKAYKKQVAOCI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|