C7H7KN2O2 — CID 67545593
potassium 3,4-diaminobenzoate (PubChem CID 67545593) has the molecular formula C7H7KN2O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is potassium 3,4-diaminobenzoate.
| Compound Name | potassium 3,4-diaminobenzoate |
|---|---|
| PubChem CID | 67545593 |
| Molecular Formula | C7H7KN2O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | potassium 3,4-diaminobenzoate |
| SMILES | Nc1ccc(C(=O)[O-])cc1N.[K+] |
| InChI | InChI=1S/C7H8N2O2.K/c8-5-2-1-4(7(10)11)3-6(5)9;/h1-3H,8-9H2,(H,10,11);/q;+1/p-1 |
| InChIKey | PBCSBQUGPCCQOQ-UHFFFAOYSA-M |
| XLogP | -3.78 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|