C18H18N4O5S — CID 67550483
N'-[6-(3,4-dimethoxyphenoxy)-2-methylsulfanylpyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 67550483) has the molecular formula C18H18N4O5S and a molecular weight of 402.43 g/mol. Its IUPAC name is N'-[6-(3,4-dimethoxyphenoxy)-2-methylsulfanylpyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-(3,4-dimethoxyphenoxy)-2-methylsulfanylpyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 67550483 |
| Molecular Formula | C18H18N4O5S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N'-[6-(3,4-dimethoxyphenoxy)-2-methylsulfanylpyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | COc1ccc(Oc2cc(NNC(=O)c3ccco3)nc(SC)n2)cc1OC |
| InChI | InChI=1S/C18H18N4O5S/c1-24-12-7-6-11(9-14(12)25-2)27-16-10-15(19-18(20-16)28-3)21-22-17(23)13-5-4-8-26-13/h4-10H,1-3H3,(H,22,23)(H,19,20,21) |
| InChIKey | BQIYQOLKAAWTNB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|