About 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one
7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one (PubChem CID 67550645) has the molecular formula C25H24N2O4
and a molecular weight of 416.48 g/mol. Its IUPAC name is 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one.
Molecular Properties
| Compound Name | 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one |
| PubChem CID | 67550645 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one |
| SMILES | COc1ccc(-c2ccc(C3=NN(C)C(=O)Cc4cc(OC)c(OC)cc43)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-27-24(28)14-19-13-22(30-3)23(31-4)15-21(19)25(26-27)18-7-5-16(6-8-18)17-9-11-20(29-2)12-10-17/h5-13,15H,14H2,1-4H3 |
| InChIKey | JEFSPAVNHMTXPS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one?
The IUPAC name of 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one (CID 67550645) is 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one.
What is the SMILES notation for 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one?
The canonical SMILES for 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one is COc1ccc(-c2ccc(C3=NN(C)C(=O)Cc4cc(OC)c(OC)cc43)cc2)cc1.
What is the InChIKey of 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one?
The InChIKey is JEFSPAVNHMTXPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O4/c1-27-24(28)14-19-13-22(30-3)23(31-4)15-21(19)25(26-27)18-7-5-16(6-8-18)17-9-11-20(29-2)12-10-17/h5-13,15H,14H2,1-4H3.
What are the key properties of 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one?
7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one has a molecular weight of 416.48 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethoxy-1-[4-(4-methoxyphenyl)phenyl]-3-methyl-5H-2,3-benzodiazepin-4-one is sourced from PubChem (CID 67550645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).