C19H16N4O4 — CID 11824645
9,10-dimethoxy-7-phenyl-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione (PubChem CID 11824645) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 9,10-dimethoxy-7-phenyl-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione.
| Compound Name | 9,10-dimethoxy-7-phenyl-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione |
|---|---|
| PubChem CID | 11824645 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 9,10-dimethoxy-7-phenyl-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)=Nn1c(n[nH]c(=O)c1=O)C2 |
| InChI | InChI=1S/C19H16N4O4/c1-26-14-8-12-9-16-20-21-18(24)19(25)23(16)22-17(11-6-4-3-5-7-11)13(12)10-15(14)27-2/h3-8,10H,9H2,1-2H3,(H,21,24) |
| InChIKey | XILTUDGIRZSMQL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|