C18H17N5O3 — CID 11792235
6-(3-aminophenyl)-8,9-dimethoxy-2,11-dihydro-[1,2,4]triazolo[4,3-c][2,3]benzodiazepin-3-one (PubChem CID 11792235) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 6-(3-aminophenyl)-8,9-dimethoxy-2,11-dihydro-[1,2,4]triazolo[4,3-c][2,3]benzodiazepin-3-one.
| Compound Name | 6-(3-aminophenyl)-8,9-dimethoxy-2,11-dihydro-[1,2,4]triazolo[4,3-c][2,3]benzodiazepin-3-one |
|---|---|
| PubChem CID | 11792235 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-(3-aminophenyl)-8,9-dimethoxy-2,11-dihydro-[1,2,4]triazolo[4,3-c][2,3]benzodiazepin-3-one |
| SMILES | COc1cc2c(cc1OC)C(c1cccc(N)c1)=Nn1c(n[nH]c1=O)C2 |
| InChI | InChI=1S/C18H17N5O3/c1-25-14-7-11-8-16-20-21-18(24)23(16)22-17(13(11)9-15(14)26-2)10-4-3-5-12(19)6-10/h3-7,9H,8,19H2,1-2H3,(H,21,24) |
| InChIKey | VJLMSRDMABRZKV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|