C29H26ClFN2O4 — CID 67551482
(2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-5-fluorobenzoate;hydrochloride (PubChem CID 67551482) has the molecular formula C29H26ClFN2O4 and a molecular weight of 520.99 g/mol. Its IUPAC name is (2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-5-fluorobenzoate;hydrochloride.
| Compound Name | (2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-5-fluorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 67551482 |
| Molecular Formula | C29H26ClFN2O4 |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | (2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-5-fluorobenzoate;hydrochloride |
| SMILES | Cl.O=C(OCC1C2CCC1N(Cc1ccccc1)C2)c1cc(F)ccc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H25FN2O4.ClH/c30-20-11-13-26(32-27(33)21-8-4-5-9-22(21)28(32)34)23(14-20)29(35)36-17-24-19-10-12-25(24)31(16-19)15-18-6-2-1-3-7-18;/h1-9,11,13-14,19,24-25H,10,12,15-17H2;1H |
| InChIKey | BXGGCDGUSZVMOT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|