C27H30N2O4 — CID 67552115
(2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl)methyl 3-methyl-2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 67552115) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is (2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl)methyl 3-methyl-2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | (2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl)methyl 3-methyl-2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 67552115 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (2-benzyl-2-azabicyclo[2.2.1]heptan-7-yl)methyl 3-methyl-2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | Cc1cccc(C(=O)OCC2C3CCC2N(Cc2ccccc2)C3)c1N1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C27H30N2O4/c1-17-7-6-10-21(25(17)29-24(30)13-18(2)26(29)31)27(32)33-16-22-20-11-12-23(22)28(15-20)14-19-8-4-3-5-9-19/h3-10,18,20,22-23H,11-16H2,1-2H3 |
| InChIKey | DYLHTFBUIDEILB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|