C18H16N2O4 — CID 10592050
pyridin-3-ylmethyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 10592050) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is pyridin-3-ylmethyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | pyridin-3-ylmethyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 10592050 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | pyridin-3-ylmethyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CC1CC(=O)N(c2ccccc2C(=O)OCc2cccnc2)C1=O |
| InChI | InChI=1S/C18H16N2O4/c1-12-9-16(21)20(17(12)22)15-7-3-2-6-14(15)18(23)24-11-13-5-4-8-19-10-13/h2-8,10,12H,9,11H2,1H3 |
| InChIKey | QUEHZRRHHFGTCY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|