C19H24N2O4 — CID 101369720
(1-methylpiperidin-2-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 101369720) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1-methylpiperidin-2-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | (1-methylpiperidin-2-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 101369720 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (1-methylpiperidin-2-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CC1CC(=O)N(c2ccccc2C(=O)OCC2CCCCN2C)C1=O |
| InChI | InChI=1S/C19H24N2O4/c1-13-11-17(22)21(18(13)23)16-9-4-3-8-15(16)19(24)25-12-14-7-5-6-10-20(14)2/h3-4,8-9,13-14H,5-7,10-12H2,1-2H3 |
| InChIKey | JKAJLTHSKIFKMZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|