C20H26N2O4 — CID 134865858
(1-ethylpiperidin-3-yl)methyl 2-[(3S)-3-methyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 134865858) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is (1-ethylpiperidin-3-yl)methyl 2-[(3S)-3-methyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | (1-ethylpiperidin-3-yl)methyl 2-[(3S)-3-methyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 134865858 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (1-ethylpiperidin-3-yl)methyl 2-[(3S)-3-methyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCN1CCCC(COC(=O)c2ccccc2N2C(=O)C[C@H](C)C2=O)C1 |
| InChI | InChI=1S/C20H26N2O4/c1-3-21-10-6-7-15(12-21)13-26-20(25)16-8-4-5-9-17(16)22-18(23)11-14(2)19(22)24/h4-5,8-9,14-15H,3,6-7,10-13H2,1-2H3/t14-,15?/m0/s1 |
| InChIKey | BINQIJHLGNUKBW-MLCCFXAWSA-N |
| XLogP | 2.47 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|