C11H12N2O6 — CID 67459347
1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate (PubChem CID 67459347) has the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate |
|---|---|
| PubChem CID | 67459347 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate |
| SMILES | O=C(O)OCc1cccnc1.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C7H7NO3.C4H5NO3/c9-7(10)11-5-6-2-1-3-8-4-6;6-3-1-2-4(7)5(3)8/h1-4H,5H2,(H,9,10);8H,1-2H2 |
| InChIKey | RNUJRLFKKIQUQZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|