1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate

C11H12N2O6 — CID 67459347

IUPAC1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate
SMILESO=C(O)OCc1cccnc1.O=C1CCC(=O)N1O
InChIInChI=1S/C7H7NO3.C4H5NO3/c9-7(10)11-5-6-2-1-3-8-4-6;6-3-1-2-4(7)5(3)8/h1-4H,5H2,(H,9,10);8H,1-2H2
InChIKeyRNUJRLFKKIQUQZ-UHFFFAOYSA-N
MW268.22 g/mol
LogP0.80
Rot. Bonds2

About 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate

1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate (PubChem CID 67459347) has the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate.

Molecular Properties

Compound Name1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate
PubChem CID67459347
Molecular FormulaC11H12N2O6
Molecular Weight268.22 g/mol
Exact Mass268.07
IUPAC Name1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate
SMILESO=C(O)OCc1cccnc1.O=C1CCC(=O)N1O
InChIInChI=1S/C7H7NO3.C4H5NO3/c9-7(10)11-5-6-2-1-3-8-4-6;6-3-1-2-4(7)5(3)8/h1-4H,5H2,(H,9,10);8H,1-2H2
InChIKeyRNUJRLFKKIQUQZ-UHFFFAOYSA-N
XLogP0.80
TPSA117.03 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.22
LogP ≤ 50.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate?
The IUPAC name of 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate (CID 67459347) is 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate.
What is the SMILES notation for 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate?
The canonical SMILES for 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate is O=C(O)OCc1cccnc1.O=C1CCC(=O)N1O.
What is the InChIKey of 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate?
The InChIKey is RNUJRLFKKIQUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.C4H5NO3/c9-7(10)11-5-6-2-1-3-8-4-6;6-3-1-2-4(7)5(3)8/h1-4H,5H2,(H,9,10);8H,1-2H2.
What are the key properties of 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate?
1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate has a molecular weight of 268.22 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypyrrolidine-2,5-dione;pyridin-3-ylmethyl hydrogen carbonate is sourced from PubChem (CID 67459347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).