C24H22N2O8 — CID 98155932
(1R,2R,3S,4S,5S,6S)-3,6-bis(pyridin-3-ylmethoxycarbonyl)bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid (PubChem CID 98155932) has the molecular formula C24H22N2O8 and a molecular weight of 466.45 g/mol. Its IUPAC name is (1R,2R,3S,4S,5S,6S)-3,6-bis(pyridin-3-ylmethoxycarbonyl)bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid.
| Compound Name | (1R,2R,3S,4S,5S,6S)-3,6-bis(pyridin-3-ylmethoxycarbonyl)bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 98155932 |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | (1R,2R,3S,4S,5S,6S)-3,6-bis(pyridin-3-ylmethoxycarbonyl)bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2C=C[C@H]([C@@H]1C(=O)OCc1cccnc1)[C@H](C(=O)O)[C@H]2C(=O)OCc1cccnc1 |
| InChI | InChI=1S/C24H22N2O8/c27-21(28)17-16-6-5-15(19(17)23(31)33-11-13-3-1-7-25-9-13)18(22(29)30)20(16)24(32)34-12-14-4-2-8-26-10-14/h1-10,15-20H,11-12H2,(H,27,28)(H,29,30)/t15-,16+,17+,18-,19-,20-/m0/s1 |
| InChIKey | UKHOJWHYTHWJTO-XGXHKTLJSA-N |
| XLogP | 1.71 |
| TPSA | 152.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|