C28H28O10 — CID 58500784
3,6-bis[[4-(hydroxymethyl)phenyl]methoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid (PubChem CID 58500784) has the molecular formula C28H28O10 and a molecular weight of 524.52 g/mol. Its IUPAC name is 3,6-bis[[4-(hydroxymethyl)phenyl]methoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid.
| Compound Name | 3,6-bis[[4-(hydroxymethyl)phenyl]methoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 58500784 |
| Molecular Formula | C28H28O10 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 3,6-bis[[4-(hydroxymethyl)phenyl]methoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid |
| SMILES | O=C(O)C1C2C=CC(C(C(=O)O)C2C(=O)OCc2ccc(CO)cc2)C1C(=O)OCc1ccc(CO)cc1 |
| InChI | InChI=1S/C28H28O10/c29-11-15-1-5-17(6-2-15)13-37-27(35)23-19-9-10-20(21(23)25(31)32)24(22(19)26(33)34)28(36)38-14-18-7-3-16(12-30)4-8-18/h1-10,19-24,29-30H,11-14H2,(H,31,32)(H,33,34) |
| InChIKey | CQXATWSRTCGHTR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|