C17H38N2O11 — CID 67554026
1,1-dimethyl-2-propylhydrazine;(2S,3R,4R,5R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol (PubChem CID 67554026) has the molecular formula C17H38N2O11 and a molecular weight of 446.49 g/mol. Its IUPAC name is 1,1-dimethyl-2-propylhydrazine;(2S,3R,4R,5R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol.
| Compound Name | 1,1-dimethyl-2-propylhydrazine;(2S,3R,4R,5R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol |
|---|---|
| PubChem CID | 67554026 |
| Molecular Formula | C17H38N2O11 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1,1-dimethyl-2-propylhydrazine;(2S,3R,4R,5R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol |
| SMILES | CCCNN(C)C.OC[C@@H](O)[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C12H24O11.C5H14N2/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12;1-4-5-6-7(2)3/h4-21H,1-3H2;6H,4-5H2,1-3H3/t4-,5+,6+,7+,8+,9-,10+,11+,12+;/m0./s1 |
| InChIKey | RCDOBLHQLAQIAJ-DNDLZOGFSA-N |
| XLogP | -5.30 |
| TPSA | 215.80 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|