C17H36N2O10 — CID 11743314
6-[3-(dimethylamino)propylamino]-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol (PubChem CID 11743314) has the molecular formula C17H36N2O10 and a molecular weight of 428.48 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propylamino]-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol.
| Compound Name | 6-[3-(dimethylamino)propylamino]-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 11743314 |
| Molecular Formula | C17H36N2O10 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 6-[3-(dimethylamino)propylamino]-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol |
| SMILES | CN(C)CCCNCC(O)C(O)C(OC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)C(O)CO |
| InChI | InChI=1S/C17H36N2O10/c1-19(2)5-3-4-18-6-9(22)12(24)16(10(23)7-20)29-17-15(27)14(26)13(25)11(8-21)28-17/h9-18,20-27H,3-8H2,1-2H3/t9?,10?,11-,12?,13+,14+,15-,16?,17?/m1/s1 |
| InChIKey | ZGEKITZQGTYPEK-ZWEQVRKRSA-N |
| XLogP | -5.21 |
| TPSA | 195.57 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | -5.21 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|