C15H17N7 — CID 67558320
N-(cyclopropylmethyl)-3-(4-hydrazinylpyrazolo[3,4-d]pyrimidin-1-yl)aniline (PubChem CID 67558320) has the molecular formula C15H17N7 and a molecular weight of 295.35 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-(4-hydrazinylpyrazolo[3,4-d]pyrimidin-1-yl)aniline.
| Compound Name | N-(cyclopropylmethyl)-3-(4-hydrazinylpyrazolo[3,4-d]pyrimidin-1-yl)aniline |
|---|---|
| PubChem CID | 67558320 |
| Molecular Formula | C15H17N7 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-(cyclopropylmethyl)-3-(4-hydrazinylpyrazolo[3,4-d]pyrimidin-1-yl)aniline |
| SMILES | NNc1ncnc2c1cnn2-c1cccc(NCC2CC2)c1 |
| InChI | InChI=1S/C15H17N7/c16-21-14-13-8-20-22(15(13)19-9-18-14)12-3-1-2-11(6-12)17-7-10-4-5-10/h1-3,6,8-10,17H,4-5,7,16H2,(H,18,19,21) |
| InChIKey | RLSGSEATDAOKGB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|