C22H43Cl2N5O4 — CID 67558574
(3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-4-oxo-3-(pentan-3-ylamino)butanoic acid;dihydrochloride (PubChem CID 67558574) has the molecular formula C22H43Cl2N5O4 and a molecular weight of 512.52 g/mol. Its IUPAC name is (3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-4-oxo-3-(pentan-3-ylamino)butanoic acid;dihydrochloride.
| Compound Name | (3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-4-oxo-3-(pentan-3-ylamino)butanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 67558574 |
| Molecular Formula | C22H43Cl2N5O4 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | (3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-4-oxo-3-(pentan-3-ylamino)butanoic acid;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N1CCC(OCCC2CCCCN2C(=O)[C@H](CC(=O)O)NC(CC)CC)CC1 |
| InChI | InChI=1S/C22H41N5O4.2ClH/c1-3-16(4-2)25-19(15-20(28)29)21(30)27-11-6-5-7-17(27)10-14-31-18-8-12-26(13-9-18)22(23)24;;/h16-19,25H,3-15H2,1-2H3,(H3,23,24)(H,28,29);2*1H/t17?,19-;;/m0../s1 |
| InChIKey | LWGGWZNPSVWLGP-KGSYHEICSA-N |
| XLogP | 2.60 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|