C25H47Cl2N5O4 — CID 67558808
(3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-3-[cyclohexyl(ethyl)amino]-4-oxobutanoic acid;dihydrochloride (PubChem CID 67558808) has the molecular formula C25H47Cl2N5O4 and a molecular weight of 552.59 g/mol. Its IUPAC name is (3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-3-[cyclohexyl(ethyl)amino]-4-oxobutanoic acid;dihydrochloride.
| Compound Name | (3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-3-[cyclohexyl(ethyl)amino]-4-oxobutanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 67558808 |
| Molecular Formula | C25H47Cl2N5O4 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | (3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-3-[cyclohexyl(ethyl)amino]-4-oxobutanoic acid;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N1CCC(OCCC2CCCCN2C(=O)[C@H](CC(=O)O)N(CC)C2CCCCC2)CC1 |
| InChI | InChI=1S/C25H45N5O4.2ClH/c1-2-29(19-8-4-3-5-9-19)22(18-23(31)32)24(33)30-14-7-6-10-20(30)13-17-34-21-11-15-28(16-12-21)25(26)27;;/h19-22H,2-18H2,1H3,(H3,26,27)(H,31,32);2*1H/t20?,22-;;/m0../s1 |
| InChIKey | XEJASNNSNMETRL-NRJYIIMNSA-N |
| XLogP | 3.47 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|