C26H47N5O4 — CID 67614299
(3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-2-yl]-3-[(3,5-dimethylcyclohexyl)-methylamino]-4-oxobutanoic acid (PubChem CID 67614299) has the molecular formula C26H47N5O4 and a molecular weight of 493.69 g/mol. Its IUPAC name is (3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-2-yl]-3-[(3,5-dimethylcyclohexyl)-methylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-2-yl]-3-[(3,5-dimethylcyclohexyl)-methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67614299 |
| Molecular Formula | C26H47N5O4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.36 |
| IUPAC Name | (3S)-4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-2-yl]-3-[(3,5-dimethylcyclohexyl)-methylamino]-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)N1CCC(OCCC2(C(=O)[C@H](CC(=O)O)N(C)C3CC(C)CC(C)C3)CCCCN2)CC1 |
| InChI | InChI=1S/C26H47N5O4/c1-18-14-19(2)16-20(15-18)30(3)22(17-23(32)33)24(34)26(8-4-5-10-29-26)9-13-35-21-6-11-31(12-7-21)25(27)28/h18-22,29H,4-17H2,1-3H3,(H3,27,28)(H,32,33)/t18?,19?,20?,22-,26?/m0/s1 |
| InChIKey | LIMFHLBOKSROGW-GAPPKZSKSA-N |
| XLogP | 2.43 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|