C25H45N5O4 — CID 57122217
4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-3-(cycloheptylmethylamino)-4-oxobutanoic acid (PubChem CID 57122217) has the molecular formula C25H45N5O4 and a molecular weight of 479.67 g/mol. Its IUPAC name is 4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-3-(cycloheptylmethylamino)-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-3-(cycloheptylmethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57122217 |
| Molecular Formula | C25H45N5O4 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.35 |
| IUPAC Name | 4-[2-[2-(1-carbamimidoylpiperidin-4-yl)oxyethyl]piperidin-1-yl]-3-(cycloheptylmethylamino)-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)N1CCC(OCCC2CCCCN2C(=O)C(CC(=O)O)NCC2CCCCCC2)CC1 |
| InChI | InChI=1S/C25H45N5O4/c26-25(27)29-14-10-21(11-15-29)34-16-12-20-9-5-6-13-30(20)24(33)22(17-23(31)32)28-18-19-7-3-1-2-4-8-19/h19-22,28H,1-18H2,(H3,26,27)(H,31,32) |
| InChIKey | CCCDZBFBESHFQH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|