C34H49BN2O7 — CID 67562709
6,7,8-trimethoxy-N-[(2S)-1-[[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxo-3-phenylpropan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 67562709) has the molecular formula C34H49BN2O7 and a molecular weight of 608.59 g/mol. Its IUPAC name is 6,7,8-trimethoxy-N-[(2S)-1-[[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxo-3-phenylpropan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 6,7,8-trimethoxy-N-[(2S)-1-[[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxo-3-phenylpropan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 67562709 |
| Molecular Formula | C34H49BN2O7 |
| Molecular Weight | 608.59 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | 6,7,8-trimethoxy-N-[(2S)-1-[[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxo-3-phenylpropan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | COc1cc2c(c(OC)c1OC)CC(C(=O)N[C@@H](Cc1ccccc1)C(=O)NC(CC(C)C)B1OC(C)(C)C(C)(C)O1)CC2 |
| InChI | InChI=1S/C34H49BN2O7/c1-21(2)17-28(35-43-33(3,4)34(5,6)44-35)37-32(39)26(18-22-13-11-10-12-14-22)36-31(38)24-16-15-23-20-27(40-7)30(42-9)29(41-8)25(23)19-24/h10-14,20-21,24,26,28H,15-19H2,1-9H3,(H,36,38)(H,37,39)/t24?,26-,28?/m0/s1 |
| InChIKey | ZZCUOQLKHXFTDX-ONOXOHQJSA-N |
| XLogP | 4.71 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|