C28H34N4O2 — CID 67565017
(2S)-N-[4-(2-ethyliminopiperidin-1-yl)phenyl]-2-isoquinolin-7-yloxy-4-methylpentanamide (PubChem CID 67565017) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is (2S)-N-[4-(2-ethyliminopiperidin-1-yl)phenyl]-2-isoquinolin-7-yloxy-4-methylpentanamide.
| Compound Name | (2S)-N-[4-(2-ethyliminopiperidin-1-yl)phenyl]-2-isoquinolin-7-yloxy-4-methylpentanamide |
|---|---|
| PubChem CID | 67565017 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (2S)-N-[4-(2-ethyliminopiperidin-1-yl)phenyl]-2-isoquinolin-7-yloxy-4-methylpentanamide |
| SMILES | CC/N=C1\CCCCN1c1ccc(NC(=O)[C@H](CC(C)C)Oc2ccc3ccncc3c2)cc1 |
| InChI | InChI=1S/C28H34N4O2/c1-4-30-27-7-5-6-16-32(27)24-11-9-23(10-12-24)31-28(33)26(17-20(2)3)34-25-13-8-21-14-15-29-19-22(21)18-25/h8-15,18-20,26H,4-7,16-17H2,1-3H3,(H,31,33)/b30-27+/t26-/m0/s1 |
| InChIKey | YTAQQSAMOWNYNG-MMZFVREHSA-N |
| XLogP | 6.08 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|