C20H14N2O2 — CID 67566850
2,13-diazapentacyclo[12.8.0.03,8.07,12.015,20]docosa-1(14),3,5,7(12),8,10,15,17,19,21-decaene-10,11-diol (PubChem CID 67566850) has the molecular formula C20H14N2O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2,13-diazapentacyclo[12.8.0.03,8.07,12.015,20]docosa-1(14),3,5,7(12),8,10,15,17,19,21-decaene-10,11-diol.
| Compound Name | 2,13-diazapentacyclo[12.8.0.03,8.07,12.015,20]docosa-1(14),3,5,7(12),8,10,15,17,19,21-decaene-10,11-diol |
|---|---|
| PubChem CID | 67566850 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2,13-diazapentacyclo[12.8.0.03,8.07,12.015,20]docosa-1(14),3,5,7(12),8,10,15,17,19,21-decaene-10,11-diol |
| SMILES | Oc1cc2c3cccc2c([nH]c2c(ccc4ccccc42)[nH]3)c1O |
| InChI | InChI=1S/C20H14N2O2/c23-17-10-14-13-6-3-7-15(14)21-16-9-8-11-4-1-2-5-12(11)18(16)22-19(13)20(17)24/h1-10,21-24H |
| InChIKey | WDBJGYMUSTYVRE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|