C13H26O2S — CID 67570441
3,3-dipentylthietane 1,1-dioxide (PubChem CID 67570441) has the molecular formula C13H26O2S and a molecular weight of 246.42 g/mol. Its IUPAC name is 3,3-dipentylthietane 1,1-dioxide.
| Compound Name | 3,3-dipentylthietane 1,1-dioxide |
|---|---|
| PubChem CID | 67570441 |
| Molecular Formula | C13H26O2S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 3,3-dipentylthietane 1,1-dioxide |
| SMILES | CCCCCC1(CCCCC)CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H26O2S/c1-3-5-7-9-13(10-8-6-4-2)11-16(14,15)12-13/h3-12H2,1-2H3 |
| InChIKey | GEQTYAVBBXLUCB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|