C28H35NO4S — CID 67570719
2-[5-(2-methoxyphenyl)sulfanyl-1-benzofuran-3-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;2-methylpropanoic acid (PubChem CID 67570719) has the molecular formula C28H35NO4S and a molecular weight of 481.66 g/mol. Its IUPAC name is 2-[5-(2-methoxyphenyl)sulfanyl-1-benzofuran-3-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;2-methylpropanoic acid.
| Compound Name | 2-[5-(2-methoxyphenyl)sulfanyl-1-benzofuran-3-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;2-methylpropanoic acid |
|---|---|
| PubChem CID | 67570719 |
| Molecular Formula | C28H35NO4S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-[5-(2-methoxyphenyl)sulfanyl-1-benzofuran-3-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;2-methylpropanoic acid |
| SMILES | CC(C)C(=O)O.COc1ccccc1Sc1ccc2occ(C3CCN4CCCCC4C3)c2c1 |
| InChI | InChI=1S/C24H27NO2S.C4H8O2/c1-26-23-7-2-3-8-24(23)28-19-9-10-22-20(15-19)21(16-27-22)17-11-13-25-12-5-4-6-18(25)14-17;1-3(2)4(5)6/h2-3,7-10,15-18H,4-6,11-14H2,1H3;3H,1-2H3,(H,5,6) |
| InChIKey | UWUWWGNQTGDTDB-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |