C33H32N4O2 — CID 67573634
benzyl carbamate;trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropan-1-amine (PubChem CID 67573634) has the molecular formula C33H32N4O2 and a molecular weight of 516.65 g/mol. Its IUPAC name is benzyl carbamate;trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropan-1-amine.
| Compound Name | benzyl carbamate;trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 67573634 |
| Molecular Formula | C33H32N4O2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | benzyl carbamate;trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropan-1-amine |
| SMILES | NC(=O)OCc1ccccc1.N[C@@H]1C[C@H]1c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C25H23N3.C8H9NO2/c26-23-16-22(23)24-17-28(18-27-24)25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21;9-8(10)11-6-7-4-2-1-3-5-7/h1-15,17-18,22-23H,16,26H2;1-5H,6H2,(H2,9,10)/t22-,23-;/m1./s1 |
| InChIKey | UHPXZZCRGPELTD-OHIDFYLOSA-N |
| XLogP | 5.82 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|