C23H30FN5 — CID 67576774
2-[[2-[(1-benzylpiperidin-4-yl)-ethylamino]-6-fluoro-3-pyridinyl]amino]-2-methylpropanenitrile (PubChem CID 67576774) has the molecular formula C23H30FN5 and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-[[2-[(1-benzylpiperidin-4-yl)-ethylamino]-6-fluoro-3-pyridinyl]amino]-2-methylpropanenitrile.
| Compound Name | 2-[[2-[(1-benzylpiperidin-4-yl)-ethylamino]-6-fluoro-3-pyridinyl]amino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 67576774 |
| Molecular Formula | C23H30FN5 |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 2-[[2-[(1-benzylpiperidin-4-yl)-ethylamino]-6-fluoro-3-pyridinyl]amino]-2-methylpropanenitrile |
| SMILES | CCN(c1nc(F)ccc1NC(C)(C)C#N)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30FN5/c1-4-29(22-20(10-11-21(24)26-22)27-23(2,3)17-25)19-12-14-28(15-13-19)16-18-8-6-5-7-9-18/h5-11,19,27H,4,12-16H2,1-3H3 |
| InChIKey | YOOBLWRQRQGFII-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|