C24H35F4OSi — CID 67579536
CID 67579536 (PubChem CID 67579536) has the molecular formula C24H35F4OSi and a molecular weight of 443.62 g/mol.
| Compound Name | CID 67579536 |
|---|---|
| PubChem CID | 67579536 |
| Molecular Formula | C24H35F4OSi |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | — |
| SMILES | FCCCC[Si]1CCC(CCC2CCC(c3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H35F4OSi/c25-15-1-2-16-30-17-13-20(14-18-30)4-3-19-5-7-21(8-6-19)22-9-11-23(12-10-22)29-24(26,27)28/h9-12,19-21H,1-8,13-18H2 |
| InChIKey | WIJWVJKHGCUSHS-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|