C27H24N6O5 — CID 67579692
acetyloxymethyl 3-[3-ethoxy-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-2-methylbenzimidazole-4-carboxylate (PubChem CID 67579692) has the molecular formula C27H24N6O5 and a molecular weight of 512.53 g/mol. Its IUPAC name is acetyloxymethyl 3-[3-ethoxy-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-2-methylbenzimidazole-4-carboxylate.
| Compound Name | acetyloxymethyl 3-[3-ethoxy-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-2-methylbenzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 67579692 |
| Molecular Formula | C27H24N6O5 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | acetyloxymethyl 3-[3-ethoxy-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-2-methylbenzimidazole-4-carboxylate |
| SMILES | CCOc1cc(-n2c(C)nc3cccc(C(=O)OCOC(C)=O)c32)ccc1-c1ccccc1-c1nn[nH]n1 |
| InChI | InChI=1S/C27H24N6O5/c1-4-36-24-14-18(12-13-20(24)19-8-5-6-9-21(19)26-29-31-32-30-26)33-16(2)28-23-11-7-10-22(25(23)33)27(35)38-15-37-17(3)34/h5-14H,4,15H2,1-3H3,(H,29,30,31,32) |
| InChIKey | QPOBDQQRGRBGSB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|