C19H19ClN4O3S3 — CID 67582883
N'-[[(3S)-3-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide (PubChem CID 67582883) has the molecular formula C19H19ClN4O3S3 and a molecular weight of 483.04 g/mol. Its IUPAC name is N'-[[(3S)-3-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide.
| Compound Name | N'-[[(3S)-3-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 67582883 |
| Molecular Formula | C19H19ClN4O3S3 |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | N'-[[(3S)-3-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide |
| SMILES | Cc1c(S(=O)(=O)N[C@H]2CCN(CN=C(N)c3cccs3)C2=O)sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H19ClN4O3S3/c1-11-13-9-12(20)4-5-15(13)29-19(11)30(26,27)23-14-6-7-24(18(14)25)10-22-17(21)16-3-2-8-28-16/h2-5,8-9,14,23H,6-7,10H2,1H3,(H2,21,22)/t14-/m0/s1 |
| InChIKey | DVCUTLIHXWYVCM-AWEZNQCLSA-N |
| XLogP | 3.17 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|