C21H23ClN2O4 — CID 67584480
3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-morpholin-4-ylprop-2-enamide (PubChem CID 67584480) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-morpholin-4-ylprop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-morpholin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 67584480 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-2-morpholin-4-ylprop-2-enamide |
| SMILES | COc1ccc(C(=C(C(N)=O)N2CCOCC2)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C21H23ClN2O4/c1-26-17-8-5-15(13-18(17)27-2)19(14-3-6-16(22)7-4-14)20(21(23)25)24-9-11-28-12-10-24/h3-8,13H,9-12H2,1-2H3,(H2,23,25) |
| InChIKey | DTKSZDKDPHBNNW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|