C22H24ClNO4 — CID 123136742
4-[3-[2-(4-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethenyl]oxiran-2-yl]morpholine (PubChem CID 123136742) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is 4-[3-[2-(4-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethenyl]oxiran-2-yl]morpholine.
| Compound Name | 4-[3-[2-(4-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethenyl]oxiran-2-yl]morpholine |
|---|---|
| PubChem CID | 123136742 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[3-[2-(4-chlorophenyl)-2-(3,4-dimethoxyphenyl)ethenyl]oxiran-2-yl]morpholine |
| SMILES | COc1ccc(C(=CC2OC2N2CCOCC2)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C22H24ClNO4/c1-25-19-8-5-16(13-20(19)26-2)18(15-3-6-17(23)7-4-15)14-21-22(28-21)24-9-11-27-12-10-24/h3-8,13-14,21-22H,9-12H2,1-2H3 |
| InChIKey | QVCTUQYCUYWUPJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|