C14H20N2O3 — CID 75361321
(E)-1-(3,4-dimethoxyphenyl)-N-morpholin-4-ylethanimine (PubChem CID 75361321) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-N-morpholin-4-ylethanimine.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-N-morpholin-4-ylethanimine |
|---|---|
| PubChem CID | 75361321 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-N-morpholin-4-ylethanimine |
| SMILES | COc1ccc(/C(C)=N/N2CCOCC2)cc1OC |
| InChI | InChI=1S/C14H20N2O3/c1-11(15-16-6-8-19-9-7-16)12-4-5-13(17-2)14(10-12)18-3/h4-5,10H,6-9H2,1-3H3/b15-11+ |
| InChIKey | ANKGYPPZWCWRHH-RVDMUPIBSA-N |
| XLogP | 1.76 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|