C17H26N2O2 — CID 23996321
1-(3,4-dimethoxyphenyl)-N-(2,6-dimethylpiperidin-1-yl)ethanimine (PubChem CID 23996321) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-(2,6-dimethylpiperidin-1-yl)ethanimine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-(2,6-dimethylpiperidin-1-yl)ethanimine |
|---|---|
| PubChem CID | 23996321 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-(2,6-dimethylpiperidin-1-yl)ethanimine |
| SMILES | COc1ccc(C(C)=NN2C(C)CCCC2C)cc1OC |
| InChI | InChI=1S/C17H26N2O2/c1-12-7-6-8-13(2)19(12)18-14(3)15-9-10-16(20-4)17(11-15)21-5/h9-13H,6-8H2,1-5H3 |
| InChIKey | JQRNJGCXMQNRHZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|