C28H29N3O5 — CID 54348483
1-[4-[1-(3,4-dimethoxyphenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]-3-phenylurea (PubChem CID 54348483) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is 1-[4-[1-(3,4-dimethoxyphenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[1-(3,4-dimethoxyphenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 54348483 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 1-[4-[1-(3,4-dimethoxyphenyl)-3-morpholin-4-yl-3-oxoprop-1-enyl]phenyl]-3-phenylurea |
| SMILES | COc1ccc(C(=CC(=O)N2CCOCC2)c2ccc(NC(=O)Nc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C28H29N3O5/c1-34-25-13-10-21(18-26(25)35-2)24(19-27(32)31-14-16-36-17-15-31)20-8-11-23(12-9-20)30-28(33)29-22-6-4-3-5-7-22/h3-13,18-19H,14-17H2,1-2H3,(H2,29,30,33) |
| InChIKey | UDZGYMGYRFYYLU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|