C26H25ClN2O5 — CID 54229760
3-[6-(2-chlorophenoxy)-3-pyridinyl]-3-(3,4-dimethoxyphenyl)-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 54229760) has the molecular formula C26H25ClN2O5 and a molecular weight of 480.95 g/mol. Its IUPAC name is 3-[6-(2-chlorophenoxy)-3-pyridinyl]-3-(3,4-dimethoxyphenyl)-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 3-[6-(2-chlorophenoxy)-3-pyridinyl]-3-(3,4-dimethoxyphenyl)-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 54229760 |
| Molecular Formula | C26H25ClN2O5 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 3-[6-(2-chlorophenoxy)-3-pyridinyl]-3-(3,4-dimethoxyphenyl)-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | COc1ccc(C(=CC(=O)N2CCOCC2)c2ccc(Oc3ccccc3Cl)nc2)cc1OC |
| InChI | InChI=1S/C26H25ClN2O5/c1-31-23-9-7-18(15-24(23)32-2)20(16-26(30)29-11-13-33-14-12-29)19-8-10-25(28-17-19)34-22-6-4-3-5-21(22)27/h3-10,15-17H,11-14H2,1-2H3 |
| InChIKey | QIKMBEGJIOYUME-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|