C27H33NO6 — CID 172747303
(E)-3-(3,4-dimethoxyphenyl)-1-morpholin-4-yl-3-[4-(4-propyl-1,3-dioxolan-2-yl)phenyl]prop-2-en-1-one (PubChem CID 172747303) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-morpholin-4-yl-3-[4-(4-propyl-1,3-dioxolan-2-yl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-morpholin-4-yl-3-[4-(4-propyl-1,3-dioxolan-2-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172747303 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-morpholin-4-yl-3-[4-(4-propyl-1,3-dioxolan-2-yl)phenyl]prop-2-en-1-one |
| SMILES | CCCC1COC(c2ccc(/C(=C\C(=O)N3CCOCC3)c3ccc(OC)c(OC)c3)cc2)O1 |
| InChI | InChI=1S/C27H33NO6/c1-4-5-22-18-33-27(34-22)20-8-6-19(7-9-20)23(17-26(29)28-12-14-32-15-13-28)21-10-11-24(30-2)25(16-21)31-3/h6-11,16-17,22,27H,4-5,12-15,18H2,1-3H3/b23-17+ |
| InChIKey | JWZGMSOEZRXCER-HAVVHWLPSA-N |
| XLogP | 4.21 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|