About 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid
6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67586083) has the molecular formula C9H10O5
and a molecular weight of 198.17 g/mol. Its IUPAC name is 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid.
Analyze 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid (CID 67586083) is 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid is CC(=O)C1(O)C=C(O)C=CC1C(=O)O.
What is the InChIKey of 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is KJMJULWCNAJGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O5/c1-5(10)9(14)4-6(11)2-3-7(9)8(12)13/h2-4,7,11,14H,1H3,(H,12,13).
What are the key properties of 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 198.17 g/mol, XLogP of 0.02, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-4,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 67586083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).