About 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid
2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid (PubChem CID 177256113) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid.
Analyze 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid?
The IUPAC name of 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid (CID 177256113) is 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid.
What is the SMILES notation for 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid?
The canonical SMILES for 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid is CC(O)(C(=O)O)C1(O)C=CC=CC1.
What is the InChIKey of 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid?
The InChIKey is MHZGAFBVHXJXNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-8(12,7(10)11)9(13)5-3-2-4-6-9/h2-5,12-13H,6H2,1H3,(H,10,11).
What are the key properties of 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid?
2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid has a molecular weight of 184.19 g/mol, XLogP of 0.07, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(1-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid is sourced from PubChem (CID 177256113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).